| Approval: | ISO |
|---|---|
| IUPAC PIN: | (2R)-2-[(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]propanoic acid |
| IUPAC name: | (2R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridyl)oxy]propanoic acid 1979 Rules: (R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridyl)oxy]propionic acid |
| CAS name: | (2R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]propanoic acid |
| CAS Reg. No.: | 2445980-81-2 |
| Formula: | C8H7Cl2FN2O3 |
| Activity: | herbicides (pyridyloxycarboxylic acid) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example fluchloraminopyr-tefuryl [2445983-82-2]. |
| Structure: |  |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | LEIWLFHGOGNSAD-UWTATZPHSA-N |
| InChI: | InChI=1S/C8H7Cl2FN2O3/c1-2(8(14)15)16-7-4(10)5(12)3(9)6(11)13-7/h2H,1H3,(H2,12,13)(H,14,15)/t2-/m1/s1 |