Approval: | ISO |
---|---|
IUPAC PIN: | [2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2H-isoindol-2-yl)-4-fluorophenoxy]acetic acid |
IUPAC name: | [2-chloro-5-(cyclohex-1-ene-1,2-dicarboximido)-4-fluorophenoxy]acetic acid |
CAS name: | 2-[2-chloro-4-fluoro-5-(1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)phenoxy]acetic acid |
CAS Reg. No.: | 87547-04-4 |
Formula: | C16H13ClFNO5 |
Activity: | herbicides (N-phenylimide) |
Notes: | Derivatives include flumiclorac-pentyl [87546-18-7]. The name “氟烯草酸” is approved in China for flumiclorac and for flumiclorac-pentyl. |
Structure: | |
Pronunciation: | floo-mǐ-klor-ǎk Guide to British pronunciation |
InChIKey: | GQQIAHNFBAFBCS-UHFFFAOYSA-N |
InChI: | InChI=1S/C16H13ClFNO5/c17-10-5-11(18)12(6-13(10)24-7-14(20)21)19-15(22)8-3-1-2-4-9(8)16(19)23/h5-6H,1-4,7H2,(H,20,21) |
A data sheet from the Compendium of Pesticide Common Names