Approval: | ISO |
---|---|
IUPAC PIN: | [(2-chloro-4-fluoro-5-{[(1Ξ)-3-oxo-5,6,7,8-tetrahydro-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene]amino}phenyl)sulfanyl]acetic acid |
IUPAC name: | [(2-chloro-4-fluoro-5-{[(EZ)-5,6,7,8-tetrahydro-3-oxo-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene]amino}phenyl)thio]acetic acid |
CAS name: | 2-[[2-chloro-4-fluoro-5-[(tetrahydro-3-oxo-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]thio]acetic acid |
CAS Reg. No.: | 149253-65-6 |
Formula: | C14H13ClFN3O3S2 |
Activity: | herbicides (N-phenylimide) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example fluthiacet-methyl [117337-19-6]. The name “qincaosuan” (嗪草酸) is approved in China. |
Structure: | |
Pronunciation: | floo-thī-a-sět Guide to British pronunciation |
InChIKey: | XWROTTLWMHCFEC-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H13ClFN3O3S2/c15-8-5-9(16)10(6-11(8)23-7-12(20)21)17-13-18-3-1-2-4-19(18)14(22)24-13/h5-6H,1-4,7H2,(H,20,21) |
A data sheet from the Compendium of Pesticide Common Names