| Approval: | ISO | 
|---|---|
| IUPAC PIN: | 4-{[(Ξ)-(dimethylamino)methylidene]amino}-3-methylphenyl methylcarbamate | 
| IUPAC name: | 4-{[(EZ)-(dimethylamino)methylidene]amino}-3-methylphenyl methylcarbamate 1979 Rules: 4-{[(EZ)-(dimethylamino)methylene]amino}-m-tolyl methylcarbamate | 
| CAS name: | N,N-dimethyl-N′-[2-methyl-4-[[(methylamino)carbonyl]oxy]phenyl]methanimidamide | 
| CAS Reg. No.: | 17702-57-7 | 
| Formula: | C12H17N3O2 | 
| Activity: | acaricides (carbamate) insecticides (carbamate) | 
| Notes: | Derivatives include formparanate hydrochloride [35452-92-7]. | 
| Structure: | |
| Pronunciation: | form-pǎr-a-nāt Guide to British pronunciation | 
| InChIKey: | NPCUJHYOBSHUJJ-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C12H17N3O2/c1-9-7-10(17-12(16)13-2)5-6-11(9)14-8-15(3)4/h5-8H,1-4H3,(H,13,16) | 
A data sheet from the Compendium of Pesticide Common Names