| Approval: | China |
|---|---|
| IUPAC PIN: | 5-(2-chlorophenyl)-N-{[2-(2-nitrobenzoyl)hydrazinyl]carbonothioyl}furan-2-carboxamide |
| IUPAC name: | 5-(2-chlorophenyl)-N-{[N′-(2-nitrobenzoyl)hydrazino]thiocarbonyl}furan-2-carboxamide |
| CAS name: | 2-nitrobenzoic acid 2-[[[[5-(2-chlorophenyl)-2-furanyl]carbonyl]amino]thioxomethyl]hydrazide |
| CAS Reg. No.: | |
| Formula: | C19H13ClN4O5S |
| Activity: | plant growth regulators (unclassified) |
| Notes: | There is no ISO common name for this substance; the name “fuphenthiourea” (呋苯硫脲) is approved in China. |
| Structure: | |
| Pronunciation: | fū-fěn-thī-ō-ūr-ē-a Guide to British pronunciation |
| InChIKey: | ZPAFHLWRBWTHTL-UHFFFAOYSA-N |
| InChI: | InChI=1S/C19H13ClN4O5S/c20-13-7-3-1-5-11(13)15-9-10-16(29-15)18(26)21-19(30)23-22-17(25)12-6-2-4-8-14(12)24(27)28/h1-10H,(H,22,25)(H2,21,23,26,30) |
A data sheet from the Compendium of Pesticide Common Names