| Status: | ISO 1750 (published) |
|---|---|
| IUPAC PIN: | (1R,2S,3r,4R,5S,6r)-1,2,3,4,5,6-hexachlorocyclohexane |
| IUPAC name: | 1α,2α,3β,4α,5α,6β-hexachlorocyclohexane |
| CAS name: | (1α,2α,3β,4α,5α,6β)-1,2,3,4,5,6-hexachlorocyclohexane |
| CAS Reg. No.: | 58-89-9 |
| Formula: | C6H6Cl6 |
| Activity: | acaricides (organochlorine) insecticides (organochlorine) |
| Notes: | The common names “gamma-BHC” and “lindane” were also formerly approved by ISO for this substance, but were withdrawn in 2020. The ISO common name for mixed isomers of hexachlorocyclohexane is HCH [608-73-1]. |
| Structure: |  |
| Pronunciation: | gǎm-a āch sē āch Guide to British pronunciation |
| InChIKey: | JLYXXMFPNIAWKQ-GNIYUCBRSA-N |
| InChI: | InChI=1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4+,5+,6+ |