| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | hexachlorobenzene |
| IUPAC name: | hexachlorobenzene 1979 Rules: perchlorobenzene |
| CAS name: | 1,2,3,4,5,6-hexachlorobenzene |
| CAS Reg. No.: | 118-74-1 |
| Formula: | C6Cl6 |
| Activity: | fungicides (organochlorine) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The systematic name “hexachlorobenzene” (六氯苯) is approved as a common name in China. The name “HCB” has been used in the literature, but it has no official approval. |
| Structure: | |
| Pronunciation: | hěks-a-klor-ō-běn-zēn Guide to British pronunciation |
| InChIKey: | CKAPSXZOOQJIBF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
A data sheet from the Compendium of Pesticide Common Names