| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | 1,1,2,3,4,4-hexachlorobuta-1,3-diene |
| IUPAC name: | hexachlorobuta-1,3-diene 1979 Rules: perchlorobuta-1,3-diene |
| CAS name: | 1,1,2,3,4,4-hexachloro-1,3-butadiene |
| CAS Reg. No.: | 87-68-3 |
| Formula: | C4Cl6 |
| Activity: | fungicides (organochlorine) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | hěks-a-klor-ō-bū-ta-dī-ēn Guide to British pronunciation |
| InChIKey: | RWNKSTSCBHKHTB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C4Cl6/c5-1(3(7)8)2(6)4(9)10 |
A data sheet from the Compendium of Pesticide Common Names