| Approval: | ESA |
|---|---|
| IUPAC PIN: | (7Z)-hexadec-7-en-1-yl acetate |
| IUPAC name: | (Z)-hexadec-7-en-1-yl acetate |
| CAS name: | (7Z)-7-hexadecen-1-yl acetate |
| CAS Reg. No.: | 23192-42-9 |
| Formula: | C18H34O2 |
| Activity: | insect attractants (Lepidopteran) |
| Notes: | There is no ISO common name for this substance; the name “hexalure” is approved by the Entomological Society of America. |
| Structure: | |
| Pronunciation: | hěks-a-lūr Guide to British pronunciation |
| InChIKey: | QVXFGVVYTKZLJN-KHPPLWFESA-N |
| InChI: | InChI=1S/C18H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h10-11H,3-9,12-17H2,1-2H3/b11-10- |
A data sheet from the Compendium of Pesticide Common Names