Status: | USSR |
---|---|
IUPAC PIN: | azepan-1-yl(phenyl)methanone |
IUPAC name: | azepan-1-yl phenyl ketone 1979 Rules: perhydroazepin-1-yl phenyl ketone |
CAS name: | (hexahydro-1H-azepin-1-yl)phenylmethanone |
CAS Reg. No.: | 3653-39-2 |
Formula: | C13H17NO |
Activity: | insect repellents |
Notes: | There is no ISO common name for this substance; the name “hexamide” (гексамид) was used in the former USSR; the name “benzimine” (бензимин) was also used. |
Structure: | |
Pronunciation: | hěks-a-mīd Guide to British pronunciation |
InChIKey: | KZLCCMBSJDXNDG-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H17NO/c15-13(12-8-4-3-5-9-12)14-10-6-1-2-7-11-14/h3-5,8-9H,1-2,6-7,10-11H2 |
A data sheet from the Compendium of Pesticide Common Names