| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | 4-(1H-indol-3-yl)butanoic acid |
| IUPAC name: | 4-(1H-indol-3-yl)butanoic acid 1979 Rules: 4-(1H-indol-3-yl)butyric acid |
| CAS name: | 1H-indole-3-butanoic acid |
| CAS Reg. No.: | 133-32-4 |
| Formula: | C12H13NO2 |
| Activity: | plant growth regulators (auxin) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “4-indolylbutyric acid” (吲哚丁酸) is approved in China. |
| Structure: | |
| Pronunciation: | ī bē ā Guide to British pronunciation |
| InChIKey: | JTEDVYBZBROSJT-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H13NO2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11/h1-2,5-6,8,13H,3-4,7H2,(H,14,15) |
A data sheet from the Compendium of Pesticide Common Names