| Approval: | ISO |
|---|---|
| IUPAC PIN: | rac-1-[(2R)-2-(2,4-dichlorophenyl)-2-(prop-2-en-1-yloxy)ethyl]-1H-imidazole |
| IUPAC name: | allyl (RS)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl ether |
| CAS name: | 1-[2-(2,4-dichlorophenyl)-2-(2-propen-1-yloxy)ethyl]-1H-imidazole |
| CAS Reg. No.: | 35554-44-0 |
| Formula: | C14H14Cl2N2O |
| Activity: | fungicides (imidazole) |
| Notes: | Derivatives include imazalil nitrate [33586-66-2], imazalil sulfate [58594-72-2]. The name “enilconazole” is approved by the World Health Organization; the Chinese version is “恩康唑” and the Russian version is “энилконазол”. The name “chloramizol” is used in South Africa. |
| Structure: |  |
| Pronunciation: | ǐm-āz-a-lǐl Guide to British pronunciation |
| InChIKey: | PZBPKYOVPCNPJY-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H14Cl2N2O/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16/h2-6,8,10,14H,1,7,9H2 |