Approval: | ISO |
---|---|
IUPAC PIN: | (4-chlorophenyl)methyl (Ξ)-N-(2,4-dichlorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanimidothioate |
IUPAC name: | 4-chlorobenzyl (EZ)-N-(2,4-dichlorophenyl)-2-(1H-1,2,4-triazol-1-yl)thioacetamidate |
CAS name: | (4-chlorophenyl)methyl N-(2,4-dichlorophenyl)-1H-1,2,4-triazole-1-ethanimidothioate |
CAS Reg. No.: | 86598-92-7 |
Formula: | C17H13Cl3N4S |
Activity: | fungicides (triazole) |
Notes: | The Chinese name “酰胺唑” has also been used in the literature, but it has no official status. |
Structure: | |
Pronunciation: | ǐm-ǐ-běn-kǒn-a-zōl Guide to British pronunciation |
InChIKey: | AGKSTYPVMZODRV-UHFFFAOYSA-N |
InChI: | InChI=1S/C17H13Cl3N4S/c18-13-3-1-12(2-4-13)9-25-17(8-24-11-21-10-22-24)23-16-6-5-14(19)7-15(16)20/h1-7,10-11H,8-9H2 |
A data sheet from the Compendium of Pesticide Common Names