| Status: | ISO 1750 (approved) |
|---|---|
| IUPAC PIN: | 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid |
| IUPAC name: | 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid pre-1969 name: 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)picolinic acid |
| CAS name: | 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)-2-pyridinecarboxylic acid |
| CAS Reg. No.: | 1628702-28-2 |
| Formula: | C14H8ClF2N3O2 |
| Activity: | herbicides (pyridinecarboxylic acid) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example indolauxipyr-cyanomethyl [2251111-18-7] |
| Structure: |  |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | CIPJEXPBJDLNIP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H8ClF2N3O2/c15-7-10(18)9(17)12(20-13(7)14(21)22)6-2-1-5-3-4-19-11(5)8(6)16/h1-4,19H,(H2,18,20)(H,21,22) |