| Approval: |
China |
| IUPAC PIN: |
3-methyl-1-(propan-2-yl)-1H-pyrazol-5-yl dimethylcarbamate |
| IUPAC name: |
1-isopropyl-3-methyl-1H-pyrazol-5-yl dimethylcarbamate |
| CAS name: |
3-methyl-1-(1-methylethyl)-1H-pyrazol-5-yl N,N-dimethylcarbamate |
| CAS Reg. No.: |
119-38-0 |
| Formula: |
C10H17N3O2 |
| Activity: |
insecticides (dimethylcarbamate) |
| Notes: |
There is no ISO common name for this substance; the name “isolan” (异索威) is approved in China, even though Isolan is (or was) a registered trade mark in many countries. |
| Structure: |
 |
| Pronunciation: |
īs-ō-lǎn Guide to British pronunciation |
| InChIKey: |
RNNBHZYEKNHLKT-UHFFFAOYSA-N |
| InChI: |
InChI=1S/C10H17N3O2/c1-7(2)13-9(6-8(3)11-13)15-10(14)12(4)5/h6-7H,1-5H3 |