| Status: |
ISO 1750 (published) |
| IUPAC PIN: |
rac-prop-2-yn-1-yl (2E,4E,7R)-3,7,11-trimethyldodeca-2,4-dienoate |
| IUPAC name: |
prop-2-ynyl (E,E)-(RS)-3,7,11-trimethyldodeca-2,4-dienoate |
| CAS name: |
2-propyn-1-yl (2E,4E)-3,7,11-trimethyl-2,4-dodecadienoate |
| CAS Reg. No.: |
42588-37-4 |
| Formula: |
C18H28O2 |
| Activity: |
insecticides (juvenile hormone mimic) |
| Notes: |
The (2E,4E,7S)-isomer [65733-20-2] is commercially available, but it does not have an ISO common name. The name “S-kinoprene” has been used in the literature, but it has no official status. |
| Structure: |
 |
| Pronunciation: |
kī-nō-prēn Guide to British pronunciation |
| InChIKey: |
FZRBKIRIBLNOAM-WHVZTFIZSA-N |
| InChI: |
InChI=1S/C18H28O2/c1-6-13-20-18(19)14-17(5)12-8-11-16(4)10-7-9-15(2)3/h1,8,12,14-16H,7,9-11,13H2,2-5H3/b12-8+,17-14+ |