Status: | China |
---|---|
IUPAC PIN: | ethyl (2Ξ)-2-{[(2Ξ)-2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoyl]oxy}-3-methylbut-3-enoate |
IUPAC name: | ethyl (2RS)-2-{{(2RS)-2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoyl]oxy}-3-methylbut-3-enoate 1979 Rules: ethyl (2RS)-2-{{(2RS)-2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propionyl]oxy}-3-methylbut-3-enoate |
CAS name: | 1-(ethoxycarbonyl)-2-methyl-2-propen-1-yl 2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]propanoate |
CAS Reg. No.: | |
Formula: | C24H23ClN2O6 |
Activity: | herbicides (aryloxyphenoxypropionic) |
Notes: | There is no ISO common name for this substance; the name “kuicaoxi” (喹草烯) is approved in China. This substance is a complex ester of quizalofop [76578-12-6]. |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | DJSHNWJVTGYEGI-UHFFFAOYSA-N |
InChI: | InChI=1S/C24H23ClN2O6/c1-5-30-24(29)22(14(2)3)33-23(28)15(4)31-17-7-9-18(10-8-17)32-21-13-26-20-12-16(25)6-11-19(20)27-21/h6-13,15,22H,2,5H2,1,3-4H3 |
A data sheet from the Compendium of Pesticide Common Names