| Approval: | China |
|---|---|
| IUPAC name: | (EZ)-N′-(2,4-dimethylphenyl)-N,N-dimethylformimidamide hydrochloride 1979 Rules: (EZ)-N1,N1-dimethyl-N2-(2,4-xylyl)formamidine hydrochloride |
| CAS name: | N′-(2,4-dimethylphenyl)-N,N-dimethylmethanimidamide monohydrochloride |
| CAS Reg. No.: | 69618-84-4 |
| Formula: | C11H17ClN2 |
| Activity: | acaricides (formamidine) insecticides (formamidine) |
| Notes: | There is no ISO common name for this substance; the name “medimeform” (杀螨脒) is approved in China. |
| Structure: | |
| Pronunciation: | mě-dī-mē-form Guide to British pronunciation |
| InChIKey: | QGIQXBSZVXYNQA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H16N2.ClH/c1-9-5-6-11(10(2)7-9)12-8-13(3)4;/h5-8H,1-4H3;1H |
A data sheet from the Compendium of Pesticide Common Names