| Approval: | WSSA | 
|---|---|
| IUPAC PIN: | 4-chlorophenyl methylcarbamate | 
| IUPAC name: | 4-chlorophenyl methylcarbamate | 
| CAS name: | 4-chlorophenyl N-methylcarbamate | 
| CAS Reg. No.: | 2620-53-3 | 
| Formula: | C8H8ClNO2 | 
| Activity: | herbicide safeners | 
| Notes: | There is no ISO common name for this substance; the name “mephenate” is approved by the Weed Science Society of America. | 
| Structure: | |
| Pronunciation: | mě-fěn-āt Guide to British pronunciation | 
| InChIKey: | WMMQJAQJAPXWDO-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C8H8ClNO2/c1-10-8(11)12-7-4-2-6(9)3-5-7/h2-5H,1H3,(H,10,11) | 
A data sheet from the Compendium of Pesticide Common Names