Approval: | WSSA |
---|---|
IUPAC PIN: | 4-chlorophenyl methylcarbamate |
IUPAC name: | 4-chlorophenyl methylcarbamate |
CAS name: | 4-chlorophenyl N-methylcarbamate |
CAS Reg. No.: | 2620-53-3 |
Formula: | C8H8ClNO2 |
Activity: | herbicide safeners |
Notes: | There is no ISO common name for this substance; the name “mephenate” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | mě-fěn-āt Guide to British pronunciation |
InChIKey: | WMMQJAQJAPXWDO-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H8ClNO2/c1-10-8(11)12-7-4-2-6(9)3-5-7/h2-5H,1H3,(H,10,11) |
A data sheet from the Compendium of Pesticide Common Names