| Approval: | ISO | 
|---|---|
| IUPAC PIN: | N-(1,3-benzothiazol-2-yl)-N,N′-dimethylurea | 
| IUPAC name: | 1-(1,3-benzothiazol-2-yl)-1,3-dimethylurea | 
| CAS name: | N-2-benzothiazolyl-N,N′-dimethylurea | 
| CAS Reg. No.: | 18691-97-9 | 
| Formula: | C10H11N3OS | 
| Activity: | algicides herbicides (urea) | 
| Notes: | The name “methibenzuron” is approved by the Weed Science Society of America. | 
| Structure: | |
| Pronunciation: | měth-a-běnz-thī-ǎz-ūr-ǒn Guide to British pronunciation | 
| InChIKey: | RRVIAQKBTUQODI-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C10H11N3OS/c1-11-9(14)13(2)10-12-7-5-3-4-6-8(7)15-10/h3-6H,1-2H3,(H,11,14) | 
A data sheet from the Compendium of Pesticide Common Names