Approval: | ISO |
---|---|
IUPAC PIN: | N2-(3-methoxypropyl)-6-(methylsulfanyl)-N4-(propan-2-yl)-1,3,5-triazine-2,4-diamine |
IUPAC name: | N2-isopropyl-N4-(3-methoxypropyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
CAS name: | N2-(3-methoxypropyl)-N4-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
CAS Reg. No.: | 841-06-5 |
Formula: | C11H21N5OS |
Activity: | herbicides (alkylthiotriazine) |
Notes: | The name “methoprotryn” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | měth-ō-prō-trīn Guide to British pronunciation |
InChIKey: | DDUIUBPJPOKOMV-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H21N5OS/c1-8(2)13-10-14-9(12-6-5-7-17-3)15-11(16-10)18-4/h8H,5-7H2,1-4H3,(H2,12,13,14,15,16) |
A data sheet from the Compendium of Pesticide Common Names