Status: | JMAFF |
---|---|
IUPAC PIN: | (4-methoxy-3-methylphenyl)(3-methylphenyl)methanone |
IUPAC name: | 4-methoxy-3,3′-dimethylbenzophenone |
CAS name: | (4-methoxy-3-methylphenyl)(3-methylphenyl)methanone |
CAS Reg. No.: | 41295-28-7 |
Formula: | C16H16O2 |
Activity: | herbicides (benzophenone) |
Notes: | There is no ISO common name for this substance; the name “methoxyphenone” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and is also approved in China (苯草酮). |
Structure: | |
Pronunciation: | měth-ǒk-sē-fēn-ōn Guide to British pronunciation |
InChIKey: | BWPYBAJTDILQPY-UHFFFAOYSA-N |
InChI: | InChI=1S/C16H16O2/c1-11-5-4-6-13(9-11)16(17)14-7-8-15(18-3)12(2)10-14/h4-10H,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names