| Approval: | ISO common name not required |
|---|---|
| IUPAC name: | 1-cyano-3-(methylmercurio)guanidine |
| CAS name: | (cyanoguanidinato-κN′)methylmercury |
| CAS Reg. No.: | 502-39-6 |
| Formula: | C3H6HgN4 |
| Activity: | fungicides (mercury compound) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “cymergan” has been used in the literature, but it has no official approval. |
| Structure: |  |
| Pronunciation: | mē-thīl-mer-kūr-ē dī-sī-ǎn-dī-ām-īd Guide to British pronunciation |
| InChIKey: | JVJUWCMBRUMDDQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C2H3N4.CH3.Hg/c3-1-6-2(4)5;;/h(H3-,4,5,6);1H3;/q-1;;+1 |