Approval: | ISO common name not required |
---|---|
IUPAC name: | methylmercury(II) pentachlorophenolate or methylmercury(II) pentachlorophenoxide or methylmercury(2+) pentachlorophenolate or methylmercury(2+) pentachlorophenoxide or methylmercuric pentachlorophenolate or methylmercuric pentachlorophenoxide |
CAS name: | methyl(pentachlorophenolato-κO)mercury |
CAS Reg. No.: | |
Formula: | C7H3Cl5HgO |
Activity: | fungicides (mercury compound) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The parent alcohol is also considered not to require a common name, see pentachlorophenol. |
Structure: | |
Pronunciation: | mē-thīl-mer-kūr-ē pěn-ta-klor-ō-fěn-ǒk-sīd Guide to British pronunciation |
InChIKey: | QFSGULCPPNDNPU-UHFFFAOYSA-M |
InChI: | InChI=1S/C6HCl5O.CH3.Hg/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h12H;1H3;/q;;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names