| Approval: | China |
|---|---|
| IUPAC PIN: | (pyridin-3-yl)methyl (4-nitrophenyl)carbamate |
| IUPAC name: | 3-pyridylmethyl (4-nitrophenyl)carbamate 1979 Rules: 3-pyridylmethyl 4-nitrocarbanilate |
| CAS name: | 3-pyridinylmethyl N-(4-nitrophenyl)carbamate |
| CAS Reg. No.: | 51594-83-3 |
| Formula: | C13H11N3O4 |
| Activity: | rodenticides (unclassified) |
| Notes: | There is no ISO common name for this substance; the name “mieshuan” (灭鼠安) is approved in China. |
| Structure: | |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | NEJBEZATSQIMQM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H11N3O4/c17-13(20-9-10-2-1-7-14-8-10)15-11-3-5-12(6-4-11)16(18)19/h1-8H,9H2,(H,15,17) |
A data sheet from the Compendium of Pesticide Common Names