| Approval: | ISO |
|---|---|
| IUPAC PIN: | N′-(4-chlorophenyl)-N,N-dimethylurea |
| IUPAC name: | 3-(4-chlorophenyl)-1,1-dimethylurea |
| CAS name: | N′-(4-chlorophenyl)-N,N-dimethylurea |
| CAS Reg. No.: | 150-68-5 |
| Formula: | C9H11ClN2O |
| Activity: | herbicides (phenylurea) |
| Notes: | Derivatives include monuron TCA [140-41-0]; the name “monuron-TCA” is approved by the Weed Science Society of America for this substance. The name “chlorfenidim” (хлорфенидим) was used in the former USSR, and the name “CMU” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | mǒn-ūr-ǒn Guide to British pronunciation |
| InChIKey: | BMLIZLVNXIYGCK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H11ClN2O/c1-12(2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13) |