Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | naphthalene |
IUPAC name: | naphthalene |
CAS name: | naphthalene |
CAS Reg. No.: | 91-20-3 |
Formula: | C10H8 |
Activity: | insecticides (aromatic hydrocarbon) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | nǎf-tha-lēn Guide to British pronunciation |
InChIKey: | UFWIBTONFRDIAS-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H |
A data sheet from the Compendium of Pesticide Common Names