| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | 2-(naphthalen-1-yl)acetamide |
| IUPAC name: | 2-(1-naphthyl)acetamide |
| CAS name: | 1-naphthaleneacetamide |
| CAS Reg. No.: | 86-86-2 |
| Formula: | C12H11NO |
| Activity: | plant growth regulators (auxin) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “NAAm” has been used in the literature, but it has no official approval. |
| Structure: |  |
| Pronunciation: | nǎf-tha-lēn-a-sēt-a-mīd Guide to British pronunciation |
| InChIKey: | XFNJVKMNNVCYEK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H11NO/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H2,13,14) |