Approval: | ISO common name not required |
---|---|
IUPAC PIN: | 1H,3H-naphtho[1,8-cd]pyran-1,3-dione |
IUPAC name: | naphthalene-1,8-dicarboxylic anhydride |
CAS name: | 1H,3H-naphtho[1,8-cd]pyran-1,3-dione |
CAS Reg. No.: | 81-84-5 |
Formula: | C12H6O3 |
Activity: | herbicide safeners |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | nǎf-thǎl-ic ǎn-hī-drīd Guide to British pronunciation |
InChIKey: | GRSMWKLPSNHDHA-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H6O3/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(14)15-11/h1-6H |
A data sheet from the Compendium of Pesticide Common Names