| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | 2-(naphthalen-1-yl)-1H-indene-1,3(2H)-dione |
| IUPAC name: | 2-(1-naphthyl)indane-1,3-dione 1979 Rules: 2-(1-naphthyl)indan-1,3-dione |
| CAS name: | 2-(1-naphthalenyl)-1H-indene-1,3(2H)-dione |
| CAS Reg. No.: | 1786-03-4 |
| Formula: | C19H12O2 |
| Activity: | rodenticides (indandione) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name, but there seems to be only one active isomer. |
| Structure: | |
| Pronunciation: | nǎf-thīl-ǐn-dān wǔn thrē dī-ōnz Guide to British pronunciation |
| InChIKey: | CVLPPWGDNNZTRW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C19H12O2/c20-18-15-9-3-4-10-16(15)19(21)17(18)14-11-5-7-12-6-1-2-8-13(12)14/h1-11,17H |
A data sheet from the Compendium of Pesticide Common Names