Approval: | ISO |
---|---|
IUPAC PIN: | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
IUPAC name: | 2′,5-dichloro-2-hydroxy-4′-nitrobenzanilide 1979 Rules: 2′,5-dichloro-4′-nitrosalicylanilide |
CAS name: | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
CAS Reg. No.: | 50-65-7 |
Formula: | C13H8Cl2N2O4 |
Activity: | molluscicides |
Notes: | Derivatives include niclosamide-olamine [1420-04-8]. The name “clonitralid” is used in Germany. |
Structure: | |
Pronunciation: | nǐ-klōs-a-mīd Guide to British pronunciation |
InChIKey: | RJMUSRYZPJIFPJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h1-6,18H,(H,16,19) |
A data sheet from the Compendium of Pesticide Common Names