| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | 3-[(2S)-pyrrolidin-2-yl]pyridine |
| IUPAC name: | 3-[(2S)-pyrrolidin-2-yl]pyridine |
| CAS name: | 3-(2S)-2-pyrrolidinylpyridine |
| CAS Reg. No.: | 494-97-3 |
| Formula: | C9H12N2 |
| Activity: | insecticides (alkaloid) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | nor-nǐk-ō-tēn Guide to British pronunciation |
| InChIKey: | MYKUKUCHPMASKF-VIFPVBQESA-N |
| InChI: | InChI=1S/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2/t9-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names