| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | 1,2-dichlorobenzene |
| IUPAC name: | o-dichlorobenzene |
| CAS name: | 1,2-dichlorobenzene |
| CAS Reg. No.: | 95-50-1 |
| Formula: | C6H4Cl2 |
| Activity: | herbicides (organochlorine) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name, with the name “ortho-dichlorobenzene” as an alternative. The name “DCB” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | or-thō dī-klor-ō-běn-zēn Guide to British pronunciation |
| InChIKey: | RFFLAFLAYFXFSW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H |