| Approval: | none |
|---|---|
| IUPAC PIN: | rac-(2R)-2-chloro-3-(3-chloro-2-methylphenyl)propanenitrile |
| IUPAC name: | (2RS)-2-chloro-3-(3-chloro-2-methylphenyl)propanenitrile 1979 Rules: (2RS)-2-chloro-3-(3-chloro-o-tolyl)propiononitrile |
| CAS name: | α,3-dichloro-2-methylbenzenepropanenitrile |
| CAS Reg. No.: | 21342-85-8 |
| Formula: | C10H8Cl2N |
| Activity: | plant growth regulators (auxin) |
| Notes: | There is no ISO common name for this substance; the name “orthonil” has been used in the literature, but it has no official approval. |
| Structure: |  |
| Pronunciation: | ǒrth-ō-nǐl Guide to British pronunciation |
| InChIKey: | YYJUXSGXHHPBTK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H9Cl2N/c1-7-8(5-9(11)6-13)3-2-4-10(7)12/h2-4,9H,5H2,1H3 |