Approval: | ISO common name not required |
---|---|
IUPAC PIN: | 7-methoxy-8-(3-methylbut-2-en-1-yl)-2H-1-benzopyran-2-one |
IUPAC name: | 7-methoxy-8-(3-methylbut-2-enyl)-2H-chromen-2-one 1979 Rules: 7-methoxy-8-(3-methylbut-2-enyl)coumarin |
CAS name: | 7-methoxy-8-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-2-one |
CAS Reg. No.: | 484-12-8 |
Formula: | C15H16O3 |
Activity: | fungicides (botanical) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “osthole” has been used in the literature, but it has no official approval. |
Structure: | |
Pronunciation: | ǒs-thǒl Guide to British pronunciation |
InChIKey: | MBRLOUHOWLUMFF-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H16O3/c1-10(2)4-7-12-13(17-3)8-5-11-6-9-14(16)18-15(11)12/h4-6,8-9H,7H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names