Approval: | ISO common name not required |
---|---|
IUPAC PIN: | 1,4-dichlorobenzene |
IUPAC name: | p-dichlorobenzene |
CAS name: | 1,4-dichlorobenzene |
CAS Reg. No.: | 106-46-7 |
Formula: | C6H4Cl2 |
Activity: | insecticides (organochlorine) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name., with the name “para-dichlorobenzene” as an alternative. |
Structure: | |
Pronunciation: | pǎr-a dī-klor-ō-běn-zēn Guide to British pronunciation |
InChIKey: | OCJBOOLMMGQPQU-UHFFFAOYSA-N |
InChI: | InChI=1S/C6H4Cl2/c7-5-1-2-6(8)4-3-5/h1-4H |
A data sheet from the Compendium of Pesticide Common Names