Approval: | ISO common name not required |
---|---|
IUPAC PIN: | nonanoic acid |
IUPAC name: | nonanoic acid |
CAS name: | nonanoic acid |
CAS Reg. No.: | 112-05-0 |
Formula: | C9H18O2 |
Activity: | herbicides (aliphatic acid) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | pěl-ar-gǒn-ǐk ǎs-ǐd Guide to British pronunciation |
InChIKey: | FBUKVWPVBMHYJY-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11) |
A data sheet from the Compendium of Pesticide Common Names