| Approval: | none |
|---|---|
| IUPAC PIN: | 5-{[(but-2-yn-1-yl)oxy]methyl}-2H-1,3-benzodioxole |
| IUPAC name: | 1,3-benzodioxol-5-ylmethyl but-2-ynyl ether 1979 Rules: but-2-ynyl piperonyl ether |
| CAS name: | 5-[(2-butynyloxy)methyl]-1,3-benzodioxole |
| CAS Reg. No.: | |
| Formula: | C12H12O3 |
| Activity: | synergists |
| Notes: | There is no ISO common name for this substance; the name “perbutin” has been used in the literature but it has no official approval. |
| Structure: |  |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | JGRBQLMBYFIVEZ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H12O3/c1-2-3-6-13-8-10-4-5-11-12(7-10)15-9-14-11/h4-5,7H,6,8-9H2,1H3 |