Approval: | ISO |
---|---|
IUPAC PIN: | 3-(methoxyformamido)phenyl (3-methylphenyl)carbamate |
IUPAC name: | 3-[(methoxyformyl)amino]phenyl (3-methylphenyl)carbamate 1979 Rules: 3-[(methoxycarbonyl)amino]phenyl 3-methylcarbanilate |
CAS name: | 3-[(methoxycarbonyl)amino]phenyl N-(3-methylphenyl)carbamate |
CAS Reg. No.: | 13684-63-4 |
Formula: | C16H16N2O4 |
Activity: | herbicides (phenyl carbamate) |
Notes: | The analogous ethyl ester has the ISO common name phenmedipham-ethyl [13684-44-1]. |
Structure: | |
Pronunciation: | fěn-měd-ǐ-fǎm Guide to British pronunciation |
InChIKey: | IDOWTHOLJBTAFI-UHFFFAOYSA-N |
InChI: | InChI=1S/C16H16N2O4/c1-11-5-3-6-12(9-11)18-16(20)22-14-8-4-7-13(10-14)17-15(19)21-2/h3-10H,1-2H3,(H,17,19)(H,18,20) |
A data sheet from the Compendium of Pesticide Common Names