| Approval: | ISO preferred name |
|---|---|
| IUPAC name: | o-(phenylmercuriooxy)phenol or phenylmercuric pyrocatecholate |
| CAS name: | (2-hydroxyphenolato-κO1,κO2)phenylmercury |
| CAS Reg. No.: | |
| Formula: | C12H10HgO2 |
| Activity: | fungicides (mercury compound) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | fē-nīl-mer-kūr-ē dǐ-rǐv-a-tǐv ǒv pīr-ō-kǎt-ǐ-chǒl Guide to British pronunciation |
| InChIKey: | IGENIDGVUSKDCC-UHFFFAOYSA-M |
| InChI: | InChI=1S/C6H6O2.C6H5.Hg/c7-5-3-1-2-4-6(5)8;1-2-4-6-5-3-1;/h1-4,7-8H;1-5H;/q;;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names