| Approval: | ISO common name not required |
|---|---|
| IUPAC name: | benzenido(2-hydroxybenzoato)mercury or phenylmercury(II) salicylate or phenylmercury(2+) salicylate or phenylmercuric salicylate |
| CAS name: | (2-hydroxybenzoato-κO1,κO2)phenylmercury |
| CAS Reg. No.: | 28086-13-7 |
| Formula: | C13H10HgO3 |
| Activity: | fungicides (mercury compound) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: |  |
| Pronunciation: | fē-nīl-mer-kūr-ē sa-lǐs-ǐl-tāt Guide to British pronunciation |
| InChIKey: | YQRBOMYQIMHOLM-UHFFFAOYSA-M |
| InChI: | InChI=1S/C7H6O3.C6H5.Hg/c8-6-4-2-1-3-5(6)7(9)10;1-2-4-6-5-3-1;/h1-4,8H,(H,9,10);1-5H;/q;;+1/p-1 |