| Approval: | ISO | 
|---|---|
| IUPAC PIN: | O-(4-chloro-3-nitrophenyl) O,O-dimethyl phosphorothioate | 
| IUPAC name: | O-(4-chloro-3-nitrophenyl) O,O-dimethyl phosphorothioate | 
| CAS name: | O-(4-chloro-3-nitrophenyl) O,O-dimethyl phosphorothioate | 
| CAS Reg. No.: | 5826-76-6 | 
| Formula: | C8H9ClNO5PS | 
| Activity: | insecticides (phenyl organothiophosphate) | 
| Notes: | * The name “nichlorfos” is used in France, but the ISO common name “phosnichlor” also appears to be used. | 
| Structure: | |
| Pronunciation: | fǒs-nǐ-klor Guide to British pronunciation | 
| InChIKey: | UFNIXJPHHIPRFX-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C8H9ClNO5PS/c1-13-16(17,14-2)15-6-3-4-7(9)8(5-6)10(11)12/h3-5H,1-2H3 | 
A data sheet from the Compendium of Pesticide Common Names