Approval: | ISO common name not required |
---|---|
IUPAC PIN: | rac-3-[(2R)-2-methylpiperidin-1-yl]propyl 3,4-dichlorobenzoate |
IUPAC name: | 3-[(2RS)-2-methylpiperidino]propyl 3,4-dichlorobenzoate |
CAS name: | 3-(2-methyl-1-piperidinyl)propyl 3,4-dichlorobenzoate |
CAS Reg. No.: | 3478-94-2 |
Formula: | C16H21Cl2NO2 |
Activity: | fungicides (piperidine) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | pǐ-pěr-a-lǐn Guide to British pronunciation |
InChIKey: | BZGLBXYQOMFXAU-UHFFFAOYSA-N |
InChI: | InChI=1S/C16H21Cl2NO2/c1-12-5-2-3-8-19(12)9-4-10-21-16(20)13-6-7-14(17)15(18)11-13/h6-7,11-12H,2-5,8-10H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names