Approval: | ISO common name not required |
---|---|
IUPAC PIN: | 5-(5,8,11,13,16,19-hexaoxatricosan-12-yl)-2H-1,3-benzodioxole |
IUPAC name: | 5-{bis[2-(2-butoxyethoxy)ethoxy]methyl}-1,3-benzodioxole or 1-bis[2-(2-butoxyethoxy)ethoxy]methyl-3,4-methylenedioxybenzene |
CAS name: | 5-[bis[2-(2-butoxyethoxy)ethoxy]methyl]-1,3-benzodioxole |
CAS Reg. No.: | 5281-13-0 |
Formula: | C24H40O8 |
Activity: | synergists |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “tropital” was rejected as an ISO common name for this substance and was later registered as a trademark. |
Structure: | |
Pronunciation: | pǐ-prō-tǎl Guide to British pronunciation |
InChIKey: | XNRCGJVOJYKMSA-UHFFFAOYSA-N |
InChI: | InChI=1S/C24H40O8/c1-3-5-9-25-11-13-27-15-17-29-24(21-7-8-22-23(19-21)32-20-31-22)30-18-16-28-14-12-26-10-6-4-2/h7-8,19,24H,3-6,9-18,20H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names