Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | potassium O-ethyl carbonodithioate |
IUPAC name: | potassium O-ethyl dithiocarbonate |
CAS name: | O-ethyl potassium carbonodithioate |
CAS Reg. No.: | 140-89-6 |
Formula: | C3H5KOS2 |
Activity: | nitrification inhibitors |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | pa-tǎs-ē-am ē-thīl-zǎn-thāt Guide to British pronunciation |
InChIKey: | JCBJVAJGLKENNC-UHFFFAOYSA-M |
InChI: | InChI=1S/C3H6OS2.K/c1-2-4-3(5)6;/h2H2,1H3,(H,5,6);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names