Approval: | none |
---|---|
IUPAC PIN: | 7-methoxy-2,2-dimethyl-2H-1-benzopyran |
IUPAC name: | 7-methoxy-2,2-dimethyl-2H-chromene |
CAS name: | 7-methoxy-2,2-dimethyl-2H-1-benzopyran |
CAS Reg. No.: | 17598-02-6 |
Formula: | C12H14O2 |
Activity: | insecticides (precocene) |
Notes: | There is no ISO common name for this substance; the name “precocene I” has been used in the literature but it has no official approval. |
Structure: | |
Pronunciation: | prǐ-kō-sēn wǔn Guide to British pronunciation |
InChIKey: | CPTJXGLQLVPIGP-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H14O2/c1-12(2)7-6-9-4-5-10(13-3)8-11(9)14-12/h4-8H,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names