| Approval: | ISO |
|---|---|
| IUPAC PIN: | 3,5-dioxo-4-propanoylcyclohexane-1-carboxylic acid |
| IUPAC name: | 3,5-dioxo-4-propanoylcyclohexanecarboxylic acid 1979 Rules: 3,5-dioxo-4-propionylcyclohexanecarboxylic acid |
| CAS name: | 3,5-dioxo-4-(1-oxopropyl)cyclohexanecarboxylic acid |
| CAS Reg. No.: | 88805-35-0 |
| Formula: | C10H12O5 |
| Activity: | plant growth regulators (growth inhibitor) |
| Notes: | Derivatives include prohexadione-calcium [124537-28-6]. The name “调环酸” is approved in China for prohexadione and for prohexadione-calcium. |
| Structure: |  |
| Pronunciation: | prō-hěks-a-dī-ōn Guide to British pronunciation |
| InChIKey: | BUCOQPHDYUOJSI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H12O5/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13/h5,9H,2-4H2,1H3,(H,14,15) |