Approval: | ISO |
---|---|
IUPAC PIN: | rac-propyl (1R,2R)-(3-oxo-2-pentylcyclopentyl)acetate containing 10±2% rac-propyl (1R,2S)-(3-oxo-2-pentylcyclopentyl)acetate |
IUPAC name: | propyl (1RS,2RS)-(3-oxo-2-pentylcyclopentyl)acetate containing 10±2% propyl (1RS,2SR)-(3-oxo-2-pentylcyclopentyl)acetate |
CAS name: | propyl (1R,2R)-rel-3-oxo-2-pentylcyclopentaneacetate |
CAS Reg. No.: | 158474-72-7 |
Formula: | C15H26O3 |
Activity: | plant growth regulators (growth inhibitor) |
Notes: | The name “PDJ” has been used in the literature but has no official approval. |
Structure: | |
Pronunciation: | prō-hī-drō-jǎz-mǒn Guide to British pronunciation |
InChIKey: | major components: IPDFPNNPBMREIF-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H26O3/c1-3-5-6-7-13-12(8-9-14(13)16)11-15(17)18-10-4-2/h12-13H,3-11H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names