Approval: | ISO |
---|---|
IUPAC PIN: | 6-(methylsulfanyl)-N2,N4-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |
IUPAC name: | N2,N4-diisopropyl-6-(methylthio)-1,3,5-triazine-2,4-diamine |
CAS name: | N2,N4-bis(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
CAS Reg. No.: | 7287-19-6 |
Formula: | C10H19N5S |
Activity: | herbicides (alkylthiotriazine) |
Notes: | The name “prometryne” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and was formerly approved by the British Standards Institution. |
Structure: | |
Pronunciation: | prō-mě-trīn Guide to British pronunciation |
InChIKey: | AAEVYOVXGOFMJO-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H19N5S/c1-6(2)11-8-13-9(12-7(3)4)15-10(14-8)16-5/h6-7H,1-5H3,(H2,11,12,13,14,15) |
A data sheet from the Compendium of Pesticide Common Names