Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | N-(3,4-dichlorophenyl)propanamide |
IUPAC name: | 3′,4′-dichloropropananilide 1979 Rules: 3′,4′-dichloropropionanilide |
CAS name: | N-(3,4-dichlorophenyl)propanamide |
CAS Reg. No.: | 709-98-8 |
Formula: | C9H9Cl2NO |
Activity: | herbicides (anilide) |
Notes: | The name “DCPA” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | prō-pa-nǐl Guide to British pronunciation |
InChIKey: | LFULEKSKNZEWOE-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H9Cl2NO/c1-2-9(13)12-6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names